Products 63177-08-2
CAS 63177-08-2 appears in our catalog under these names: 2-(carboxymethyl)-4-chlorobenzoic acid, 95%, 2-(Carboxymethyl)-4-chlorobenzoic acid 95%, 2-(Carboxymethyl)-4-chlorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-(carboxymethyl)-4-chlorobenzoic acid (CAS 63177-08-2) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 2-(carboxymethyl)-4-chlorobenzoic acid. InChIKey: WVTJEXSVQSHCPZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-(carboxymethyl)-4-chlorobenzoic acid |
| InChIKey | WVTJEXSVQSHCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)