CAS 1734-62-9 appears in our catalog under these names: 2-(Acetyloxy)-5-chlorobenzoic acid, 95%, 2-(Acetyloxy)-5-chlorobenzoic acid, 2-(acetyloxy)-5-chlorobenzoic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 2,5g, 250mg.
2-acetyloxy-5-chlorobenzoic acid (CAS 1734-62-9) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 2-acetyloxy-5-chlorobenzoic acid. InChIKey: CNWHHQWYXIPHGY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-acetyloxy-5-chlorobenzoic acid |
| InChIKey | CNWHHQWYXIPHGY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)