CAS 1490946-47-8 is the registry number for Methyl 3-chloro-4,5-methylenedioxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 7-chloro-1,3-benzodioxole-5-carboxylate (CAS 1490946-47-8) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: methyl 7-chloro-1,3-benzodioxole-5-carboxylate. InChIKey: SGGCOTOBSQPEJR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | methyl 7-chloro-1,3-benzodioxole-5-carboxylate |
| InChIKey | SGGCOTOBSQPEJR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Cl)OCO2 |
Computed by PubChem (NCBI)