CAS 66410-93-3 is the registry number for 7-Chloro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 66410-93-3) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: JMIKCDZBVNZHGZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | JMIKCDZBVNZHGZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2O1)Cl)C(=O)O |
Computed by PubChem (NCBI)