Products 1820706-11-3
CAS 1820706-11-3 is the registry number for 5,7-dichloro-6-ethyl-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dichloro-6-ethyl-1,3-benzoxazol-2-amine (CAS 1820706-11-3) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 5,7-dichloro-6-ethyl-1,3-benzoxazol-2-amine. InChIKey: DPMNHUVMEOPHSS-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 5,7-dichloro-6-ethyl-1,3-benzoxazol-2-amine |
| InChIKey | DPMNHUVMEOPHSS-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C2C(=C1Cl)OC(=N2)N)Cl |
Computed by PubChem (NCBI)