Products 39250-16-3
CAS 39250-16-3 is the registry number for (1E)-N-(3-Chlorophenyl)-2-oxopropanehydrazonoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(1E)-N-(3-chlorophenyl)-2-oxopropanehydrazonoyl chloride (CAS 39250-16-3) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: (1E)-N-(3-chlorophenyl)-2-oxopropanehydrazonoyl chloride. InChIKey: DRQRXNVIADUUCG-UKTHLTGXSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | (1E)-N-(3-chlorophenyl)-2-oxopropanehydrazonoyl chloride |
| InChIKey | DRQRXNVIADUUCG-UKTHLTGXSA-N |
| SMILES | CC(=O)/C(=N\NC1=CC(=CC=C1)Cl)/Cl |
Computed by PubChem (NCBI)