CAS 41510-16-1 appears in our catalog under these names: 1-(6-Chloro-1h-benzimidazol-2-yl)ethanone hydrochloride, 95%, 1-(6-Chloro-1h-benzimidazol-2-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
1-(6-chloro-1H-benzimidazol-2-yl)ethanone;hydrochloride (CAS 41510-16-1) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 1-(6-chloro-1H-benzimidazol-2-yl)ethanone;hydrochloride. InChIKey: USRMLVBHAWNBLU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 1-(6-chloro-1H-benzimidazol-2-yl)ethanone;hydrochloride |
| InChIKey | USRMLVBHAWNBLU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC2=C(N1)C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)