CAS 1577471-53-4 is the registry number for 6,9-Dichloro-1,2,3,4-tetrahydro-5H-benzo[e][1,4]diazepin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,9-dichloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 1577471-53-4) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 6,9-dichloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: FFNMMSXQMVDZES-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 6,9-dichloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | FFNMMSXQMVDZES-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(C=CC(=C2N1)Cl)Cl |
Computed by PubChem (NCBI)