CAS 876729-84-9 is the registry number for (2E)-3-(2,4-Dichlorophenyl)prop-2-enehydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide (CAS 876729-84-9) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: (E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide. InChIKey: WWOAAMJEUHUILM-DUXPYHPUSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | (E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide |
| InChIKey | WWOAAMJEUHUILM-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=C/C(=O)NN |
Computed by PubChem (NCBI)