CAS 906352-57-6 appears in our catalog under these names: 1-Methyl-1h-benzimidazole-5-carbonyl chloride hydrochloride, 95%, 1-Methyl-1H-benzimidazole-5-carbonyl chloride hydrochloride, 90% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
1-methylbenzimidazole-5-carbonyl chloride;hydrochloride (CAS 906352-57-6) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 1-methylbenzimidazole-5-carbonyl chloride;hydrochloride. InChIKey: SGNORNZSRSQMEE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 1-methylbenzimidazole-5-carbonyl chloride;hydrochloride |
| InChIKey | SGNORNZSRSQMEE-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C=CC(=C2)C(=O)Cl.Cl |
Computed by PubChem (NCBI)