Products 18247-78-4

CAS 18247-78-4 is the registry number for (1E)-N-(4-Chlorophenyl)-2-oxopropanehydrazonoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

N-(4-chlorophenyl)-2-oxopropanehydrazonoyl chloride (CAS 18247-78-4) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: N-(4-chlorophenyl)-2-oxopropanehydrazonoyl chloride. InChIKey: RJHCGGWBOWGPJS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2N2O
Molecular weight231.08 g/mol
IUPAC nameN-(4-chlorophenyl)-2-oxopropanehydrazonoyl chloride
InChIKeyRJHCGGWBOWGPJS-UHFFFAOYSA-N
SMILESCC(=O)C(=NNC1=CC=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)