Products 1820707-26-3
CAS 1820707-26-3 is the registry number for methyl 5-(3-hydroxyphenyl)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 5-(3-hydroxyphenyl)pyridine-3-carboxylate (CAS 1820707-26-3) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: methyl 5-(3-hydroxyphenyl)pyridine-3-carboxylate. InChIKey: XIEDVSREQZLUFE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | methyl 5-(3-hydroxyphenyl)pyridine-3-carboxylate |
| InChIKey | XIEDVSREQZLUFE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)