CAS 1820735-11-2 appears in our catalog under these names: Imidazo(1,2-a)pyrazine-8-carboxylic acid hydrochloride, 98%, Imidazo(1,2-a)pyrazine-8-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
Imidazo[1,2-a]pyrazine-8-carboxylic acid;hydrochloride (CAS 1820735-11-2) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: imidazo[1,2-a]pyrazine-8-carboxylic acid;hydrochloride. InChIKey: XPYKSQQPQRNPHJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | imidazo[1,2-a]pyrazine-8-carboxylic acid;hydrochloride |
| InChIKey | XPYKSQQPQRNPHJ-UHFFFAOYSA-N |
| SMILES | C1=CN2C=CN=C2C(=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)