Products 2868296-12-0
CAS 2868296-12-0 is the registry number for 6-Chloro-4-methoxyisoxazolo[5,4-b]pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine (CAS 2868296-12-0) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: 6-chloro-4-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine. InChIKey: ZEFZESMCRCTTOO-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 6-chloro-4-methoxy-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| InChIKey | ZEFZESMCRCTTOO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC2=C1C(=NO2)N)Cl |
Computed by PubChem (NCBI)