Products 316352-05-3
CAS 316352-05-3 appears in our catalog under these names: Imidazo[1,2-b]pyridazine-6-carboxylic acid hydrochloride, 95%, Imidazo(1,2-b)pyridazine-6-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Imidazo[1,2-b]pyridazine-6-carboxylic acid;hydrochloride (CAS 316352-05-3) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: imidazo[1,2-b]pyridazine-6-carboxylic acid;hydrochloride. InChIKey: BJQLBJXJUWISOV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | imidazo[1,2-b]pyridazine-6-carboxylic acid;hydrochloride |
| InChIKey | BJQLBJXJUWISOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2N=C1C(=O)O.Cl |
Computed by PubChem (NCBI)