CAS 1881329-19-6 is the registry number for 4-nitro-1H-indazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-nitro-1H-indazole;hydrochloride (CAS 1881329-19-6) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: 4-nitro-1H-indazole;hydrochloride. InChIKey: RZPLQJSBIHYIIN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 4-nitro-1H-indazole;hydrochloride |
| InChIKey | RZPLQJSBIHYIIN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2)C(=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)