CAS 2459489-14-4 is the registry number for 5-Chloro-4-methyl-1,4-dihydro-2H-pyrimido[4,5-d][1,3]oxazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4-methyl-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one (CAS 2459489-14-4) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: 5-chloro-4-methyl-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one. InChIKey: UCXVUYVBCHLUEN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 5-chloro-4-methyl-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one |
| InChIKey | UCXVUYVBCHLUEN-UHFFFAOYSA-N |
| SMILES | CC1C2=C(NC(=O)O1)N=CN=C2Cl |
Computed by PubChem (NCBI)