CAS 60494-50-0 appears in our catalog under these names: 4-Chloropyridine-2,6-dicarboxamide, 98%, 2,6-Pyridinedicarboxamide, 4-chloro-, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
4-chloropyridine-2,6-dicarboxamide (CAS 60494-50-0) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: 4-chloropyridine-2,6-dicarboxamide. InChIKey: HHBZVWNONJGHQZ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 4-chloropyridine-2,6-dicarboxamide |
| InChIKey | HHBZVWNONJGHQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)N)C(=O)N)Cl |
Computed by PubChem (NCBI)