Products 182218-15-1
CAS 182218-15-1 is the registry number for Methyl 3-cyano-2-oxo-3-(pyridin-2-yl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-cyano-2-oxo-3-pyridin-2-ylpropanoate (CAS 182218-15-1) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 3-cyano-2-oxo-3-pyridin-2-ylpropanoate. InChIKey: WQYJMLLNWWBWQT-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 3-cyano-2-oxo-3-pyridin-2-ylpropanoate |
| InChIKey | WQYJMLLNWWBWQT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C(C#N)C1=CC=CC=N1 |
Computed by PubChem (NCBI)