Products 182261-94-5
CAS 182261-94-5 is the registry number for Clausine I. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-hydroxy-6-methoxy-9H-carbazole-3-carbaldehyde (CAS 182261-94-5) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 1-hydroxy-6-methoxy-9H-carbazole-3-carbaldehyde. InChIKey: AMRVXYRVPBLMCN-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-hydroxy-6-methoxy-9H-carbazole-3-carbaldehyde |
| InChIKey | AMRVXYRVPBLMCN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C2C=C(C=C3O)C=O |
Computed by PubChem (NCBI)