Products 1822758-35-9

CAS 1822758-35-9 is the registry number for 2-(tert-Butoxycarbonyl)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid (CAS 1822758-35-9) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid. InChIKey: JBBMXPFFCFHKDD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid
InChIKeyJBBMXPFFCFHKDD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CCC1C(=O)O

Computed by PubChem (NCBI)