CAS 2969617-82-9 is the registry number for (1S,2S)-2-tert-butoxycarbonylcyclobutanecarboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid (CAS 2969617-82-9) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid. InChIKey: JBBMXPFFCFHKDD-BQBZGAKWSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid |
| InChIKey | JBBMXPFFCFHKDD-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)