Products 1822788-58-8
CAS 1822788-58-8 is the registry number for 6-Fluoro-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1822788-58-8) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 6-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: QIKLOIGZWSEAMU-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 6-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | QIKLOIGZWSEAMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(C2)C(=O)O)F |
Computed by PubChem (NCBI)