CAS 1822848-83-8 is the registry number for Phenylmethyl 6-(trifluoromethoxy)-3-pyridinecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzyl 6-(trifluoromethoxy)pyridine-3-carboxylate (CAS 1822848-83-8) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: benzyl 6-(trifluoromethoxy)pyridine-3-carboxylate. InChIKey: ZUCXTHLUOZOWLE-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | benzyl 6-(trifluoromethoxy)pyridine-3-carboxylate |
| InChIKey | ZUCXTHLUOZOWLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CN=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)