CAS 1823359-63-2 appears in our catalog under these names: Methyl 2,6-dichloro-4-(methylthio)benzoate, 95%, Methyl 2,6-dichloro-4-(methylthio)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 2,6-dichloro-4-methylsulfanylbenzoate (CAS 1823359-63-2) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: methyl 2,6-dichloro-4-methylsulfanylbenzoate. InChIKey: WWRKKZMJGOYRCL-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | methyl 2,6-dichloro-4-methylsulfanylbenzoate |
| InChIKey | WWRKKZMJGOYRCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)SC)Cl |
Computed by PubChem (NCBI)