CAS 325700-70-7 is the registry number for Methyl 2-[(2,5-dichlorophenyl)sulfanyl]acetate, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Methyl 2-(2,5-dichlorophenyl)sulfanylacetate (CAS 325700-70-7) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: methyl 2-(2,5-dichlorophenyl)sulfanylacetate. InChIKey: FXXZQUQWSSEKRI-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | methyl 2-(2,5-dichlorophenyl)sulfanylacetate |
| InChIKey | FXXZQUQWSSEKRI-UHFFFAOYSA-N |
| SMILES | COC(=O)CSC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)