Products 71735-21-2
CAS 71735-21-2 is the registry number for 2-((2,4-Dichloro-5-methylphenyl)thio)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichloro-5-methylphenyl)sulfanylacetic acid (CAS 71735-21-2) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: 2-(2,4-dichloro-5-methylphenyl)sulfanylacetic acid. InChIKey: VPCNIUHVMZIJDP-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-(2,4-dichloro-5-methylphenyl)sulfanylacetic acid |
| InChIKey | VPCNIUHVMZIJDP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)Cl)SCC(=O)O |
Computed by PubChem (NCBI)