CAS 65051-31-2 appears in our catalog under these names: 2-{((2,4-Dichlorophenyl)methyl)sulfanyl}acetic acid, 2-([(2,4-Dichlorophenyl)methyl]sulfanyl)acetic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 100mg, 5g, 250mg.
2-[(2,4-dichlorophenyl)methylsulfanyl]acetic acid (CAS 65051-31-2) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylsulfanyl]acetic acid. InChIKey: GWTAKOPAASARET-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylsulfanyl]acetic acid |
| InChIKey | GWTAKOPAASARET-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CSCC(=O)O |
Computed by PubChem (NCBI)