CAS 2029703-66-8 is the registry number for Rel-(1R,2S)-2-(3-chlorophenyl)cyclopropane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1R,2S)-2-(3-chlorophenyl)cyclopropane-1-sulfonyl chloride (CAS 2029703-66-8) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: trans-(1R,2S)-2-(3-chlorophenyl)cyclopropane-1-sulfonyl chloride. InChIKey: OSJUKSATPIMPLU-DTWKUNHWSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-chlorophenyl)cyclopropane-1-sulfonyl chloride |
| InChIKey | OSJUKSATPIMPLU-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1S(=O)(=O)Cl)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)