CAS 65051-35-6 appears in our catalog under these names: 2-((2,6-DICHLOROBENZYL)THIO)ACETIC ACID, 95%, 95%, 2-((2,6-Dichlorobenzyl)thio)acetic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[(2,6-dichlorophenyl)methylsulfanyl]acetic acid (CAS 65051-35-6) is a chemical compound with the molecular formula C9H8Cl2O2S and a molecular weight of 251.13 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)methylsulfanyl]acetic acid. InChIKey: GQCUTKINPPGWHJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2S |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)methylsulfanyl]acetic acid |
| InChIKey | GQCUTKINPPGWHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CSCC(=O)O)Cl |
Computed by PubChem (NCBI)