CAS 1823552-85-7 is the registry number for 8-Chloro-6-methoxychromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1823552-85-7) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: 8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ZFROMPPOQDCHJM-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | ZFROMPPOQDCHJM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)Cl)OCC(C2)C(=O)O |
Computed by PubChem (NCBI)