Products 1823552-85-7

CAS 1823552-85-7 is the registry number for 8-Chloro-6-methoxychromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1823552-85-7) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: 8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ZFROMPPOQDCHJM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO4
Molecular weight242.65 g/mol
IUPAC name8-chloro-6-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyZFROMPPOQDCHJM-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C(=C1)Cl)OCC(C2)C(=O)O

Computed by PubChem (NCBI)