Products 1823966-84-2
CAS 1823966-84-2 is the registry number for 3,3-dichloro-1-phenylpiperidin-2-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,3-dichloro-1-phenylpiperidin-2-one (CAS 1823966-84-2) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: 3,3-dichloro-1-phenylpiperidin-2-one. InChIKey: XNZJWVBGHGKZEG-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 3,3-dichloro-1-phenylpiperidin-2-one |
| InChIKey | XNZJWVBGHGKZEG-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC=CC=C2)(Cl)Cl |
Computed by PubChem (NCBI)