Products 1823998-53-3
CAS 1823998-53-3 appears in our catalog under these names: 2–(4–bromo–3–fluorophenyl)–2，2–difluoroacetic acid, 2-(4-Bromo-3-fluorophenyl)-2,2-difluoroacetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetic acid (CAS 1823998-53-3) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetic acid. InChIKey: MMAYMBJGDPLMLI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetic acid |
| InChIKey | MMAYMBJGDPLMLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)(F)F)F)Br |
Computed by PubChem (NCBI)