Products 1824074-89-6
CAS 1824074-89-6 is the registry number for tert-Butyl 7-hydroxy-3-oxo-3,4-dihydroquinoxaline-1(2H)-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 7-hydroxy-3-oxo-2,4-dihydroquinoxaline-1-carboxylate (CAS 1824074-89-6) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl 7-hydroxy-3-oxo-2,4-dihydroquinoxaline-1-carboxylate. InChIKey: IACJJXKHYBNSTG-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl 7-hydroxy-3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| InChIKey | IACJJXKHYBNSTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC2=C1C=C(C=C2)O |
Computed by PubChem (NCBI)