CAS 18241-98-0 appears in our catalog under these names: 3-((3-Nitrophenyl)amino)propanoic acid, 95%, 3–((3–Nitrophenyl)amino)propanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(3-nitroanilino)propanoic acid (CAS 18241-98-0) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 3-(3-nitroanilino)propanoic acid. InChIKey: IZZCWSDYYODXRI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 3-(3-nitroanilino)propanoic acid |
| InChIKey | IZZCWSDYYODXRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NCCC(=O)O |
Computed by PubChem (NCBI)