CAS 1824462-35-2 is the registry number for 1-Benzylcyclopropane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzylcyclopropane-1-sulfonyl chloride (CAS 1824462-35-2) is a chemical compound with the molecular formula C10H11ClO2S and a molecular weight of 230.71 g/mol. IUPAC name: 1-benzylcyclopropane-1-sulfonyl chloride. InChIKey: LKLCFJUOUDPQAR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | 1-benzylcyclopropane-1-sulfonyl chloride |
| InChIKey | LKLCFJUOUDPQAR-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)