Products 1824621-44-4
CAS 1824621-44-4 is the registry number for 5,7-Dichlorochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1824621-44-4) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 5,7-dichloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: JMTCKVHIJPGSFS-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 5,7-dichloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | JMTCKVHIJPGSFS-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5,7-Dichlorochromane-3-carboxylic acid