CAS 1824725-09-8 appears in our catalog under these names: Norepinephrine Impurity 34, 1-Hydroxy-1-(3-hydroxyphenyl)-2-propanone Oxime. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
3-(1-hydroxy-2-hydroxyiminopropyl)phenol (CAS 1824725-09-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3-(1-hydroxy-2-hydroxyiminopropyl)phenol. InChIKey: VVCLQUZJZTZKOH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-(1-hydroxy-2-hydroxyiminopropyl)phenol |
| InChIKey | VVCLQUZJZTZKOH-UHFFFAOYSA-N |
| SMILES | CC(=NO)C(C1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)