CAS 183075-03-8 appears in our catalog under these names: 3,4–O–Isopropylidene–shikimic acid, 3,4-O-Isopropylidene-shikimic acid/ 99.47% (existing batch purity), 3,4-o-Isopropylidene shikimic acid, 3,4-O-Isopropylidene-shikimic acid, 99.48%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid (CAS 183075-03-8) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: 7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid. InChIKey: PILATNHSTHZMCA-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | PILATNHSTHZMCA-UHFFFAOYSA-N |
| SMILES | CC1(OC2C=C(CC(C2O1)O)C(=O)O)C |
Computed by PubChem (NCBI)