Products 1832611-33-2
CAS 1832611-33-2 is the registry number for tert-Butyl-N-[(Z,1S)-1-methyl-3-methylsulfonylallyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(Z,2S)-4-methylsulfonylbut-3-en-2-yl]carbamate (CAS 1832611-33-2) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: tert-butyl N-[(Z,2S)-4-methylsulfonylbut-3-en-2-yl]carbamate. InChIKey: ZHNMMAGSBWJDQP-UAPHAKCISA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | tert-butyl N-[(Z,2S)-4-methylsulfonylbut-3-en-2-yl]carbamate |
| InChIKey | ZHNMMAGSBWJDQP-UAPHAKCISA-N |
| SMILES | C[C@@H](/C=C\S(=O)(=O)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)