Products 3008208-51-0
CAS 3008208-51-0 is the registry number for tert-butyl (R,E)-(4-(methylsulfonyl)but-3-en-2-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(E,2R)-4-methylsulfonylbut-3-en-2-yl]carbamate (CAS 3008208-51-0) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: tert-butyl N-[(E,2R)-4-methylsulfonylbut-3-en-2-yl]carbamate. InChIKey: ZHNMMAGSBWJDQP-HYDMIIDASA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | tert-butyl N-[(E,2R)-4-methylsulfonylbut-3-en-2-yl]carbamate |
| InChIKey | ZHNMMAGSBWJDQP-HYDMIIDASA-N |
| SMILES | C[C@H](/C=C/S(=O)(=O)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)