Products 183448-41-1
CAS 183448-41-1 appears in our catalog under these names: Dimethyl 3-fluorophthalate, 95%, 1,2-DIMETHYL 3-FLUOROBENZENE-1,2-DICARBOXYLATE, 97%, Dimethyl 3-Fluorophthalate, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
Dimethyl 3-fluorobenzene-1,2-dicarboxylate (CAS 183448-41-1) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 3-fluorobenzene-1,2-dicarboxylate. InChIKey: CHGPELMANYOUNH-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 3-fluorobenzene-1,2-dicarboxylate |
| InChIKey | CHGPELMANYOUNH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)F)C(=O)OC |
Computed by PubChem (NCBI)