CAS 184416-84-0 appears in our catalog under these names: 2,3–dichloro pyridine–4–carboxylic acid, 2,3-Dichloropyridine-4-carboxylic acid, 2,3-Dichloropyridine-4-carboxylic acid, 97% , 2,3-Dichloroisonicotinic acid 98%, 2,3-Dichloroisonicotinic acid, 98%, 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g, 100g, 500g.
2,3-dichloropyridine-4-carboxylic acid (CAS 184416-84-0) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,3-dichloropyridine-4-carboxylic acid. InChIKey: VGKZZKKTZKRCPA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,3-dichloropyridine-4-carboxylic acid |
| InChIKey | VGKZZKKTZKRCPA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)