Products 18451-69-9
CAS 18451-69-9 is the registry number for 3-(4-nitrophenyl)-1-(pyridin-2-yl)prop-2-en-1-one, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
3-(4-nitrophenyl)-1-pyridin-2-ylprop-2-en-1-one (CAS 18451-69-9) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 3-(4-nitrophenyl)-1-pyridin-2-ylprop-2-en-1-one. InChIKey: ABZNBGWNJJAEIN-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1-pyridin-2-ylprop-2-en-1-one |
| InChIKey | ABZNBGWNJJAEIN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C=CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)