CAS 184636-51-9 is the registry number for Methyl(R)-2-Amino-2-benzyl-3,3,3-trifluoropropanoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate (CAS 184636-51-9) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate. InChIKey: XQERQOFFMFOSES-SNVBAGLBSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate |
| InChIKey | XQERQOFFMFOSES-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@](CC1=CC=CC=C1)(C(F)(F)F)N |
Computed by PubChem (NCBI)