CAS 1848223-48-2 is the registry number for 4′,5′-Didehydro-5′-deoxy-2′-O-methyluridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,4S)-4-hydroxy-3-methoxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione (CAS 1848223-48-2) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: 1-[(2R,3R,4S)-4-hydroxy-3-methoxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: AYTOADFYFHPUBK-IWSPIJDZSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 1-[(2R,3R,4S)-4-hydroxy-3-methoxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | AYTOADFYFHPUBK-IWSPIJDZSA-N |
| SMILES | CO[C@@H]1[C@@H](C(=C)O[C@H]1N2C=CC(=O)NC2=O)O |
Computed by PubChem (NCBI)