CAS 185030-83-5 is the registry number for (S)-2-Amino-3-(2-chlorophenyl)propanoic acid hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-2-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride (CAS 185030-83-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2S)-2-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride. InChIKey: JDVNKKKRAFSXTH-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | JDVNKKKRAFSXTH-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)