Products 18516-19-3
CAS 18516-19-3 is the registry number for 2,2-Dimethyl-3-((4-methylbenzenesulfonyl)oxy)propanal. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,2-dimethyl-3-oxopropyl) 4-methylbenzenesulfonate (CAS 18516-19-3) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: (2,2-dimethyl-3-oxopropyl) 4-methylbenzenesulfonate. InChIKey: ZETOSWREBWGSHW-UHFFFAOYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | (2,2-dimethyl-3-oxopropyl) 4-methylbenzenesulfonate |
| InChIKey | ZETOSWREBWGSHW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)(C)C=O |
Computed by PubChem (NCBI)