Products 1854924-00-7
CAS 1854924-00-7 is the registry number for 2-(Methylthio)pyrido[3,4-d]pyrimidin-4(3H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methylsulfanyl-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 1854924-00-7) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 2-methylsulfanyl-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: WFYRYDQPGDUUNZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 2-methylsulfanyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | WFYRYDQPGDUUNZ-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C=CN=C2)C(=O)N1 |
Computed by PubChem (NCBI)