CAS 1858250-10-8 appears in our catalog under these names: 6-Chloro-2,4-difluoro-3-methylphenylacetic acid, 95%, 6-Chloro-2,4-difluoro-3-methylphenylacetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
2-(6-chloro-2,4-difluoro-3-methylphenyl)acetic acid (CAS 1858250-10-8) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 2-(6-chloro-2,4-difluoro-3-methylphenyl)acetic acid. InChIKey: HORMEUGYUQGAOW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 2-(6-chloro-2,4-difluoro-3-methylphenyl)acetic acid |
| InChIKey | HORMEUGYUQGAOW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Cl)CC(=O)O)F |
Computed by PubChem (NCBI)